C17H26O5S2 — CID 131974497
(1S,3S,7R,9S)-8-methyl-5,11-bis(thiolan-2-yl)-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-ol (PubChem CID 131974497) has the molecular formula C17H26O5S2 and a molecular weight of 374.52 g/mol. Its IUPAC name is (1S,3S,7R,9S)-8-methyl-5,11-bis(thiolan-2-yl)-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-ol.
| Compound Name | (1S,3S,7R,9S)-8-methyl-5,11-bis(thiolan-2-yl)-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-ol |
|---|---|
| PubChem CID | 131974497 |
| Molecular Formula | C17H26O5S2 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | (1S,3S,7R,9S)-8-methyl-5,11-bis(thiolan-2-yl)-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-ol |
| SMILES | CC1[C@H]2OC(C3CCCS3)O[C@H]2C(O)[C@@H]2OC(C3CCCS3)O[C@@H]12 |
| InChI | InChI=1S/C17H26O5S2/c1-8-12-14(21-16(19-12)9-4-2-6-23-9)11(18)15-13(8)20-17(22-15)10-5-3-7-24-10/h8-18H,2-7H2,1H3/t8?,9?,10?,11?,12-,13+,14-,15-,16?,17?/m0/s1 |
| InChIKey | HBUUZJWGBPNBEW-LVUVUXMPSA-N |
| XLogP | 2.01 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |