C9H19NO2 — CID 13197450
(3R)-3-hydroxy-N,N,4,4-tetramethylpentanamide (PubChem CID 13197450) has the molecular formula C9H19NO2 and a molecular weight of 173.26 g/mol. Its IUPAC name is (3R)-3-hydroxy-N,N,4,4-tetramethylpentanamide.
| Compound Name | (3R)-3-hydroxy-N,N,4,4-tetramethylpentanamide |
|---|---|
| PubChem CID | 13197450 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | (3R)-3-hydroxy-N,N,4,4-tetramethylpentanamide |
| SMILES | CN(C)C(=O)C[C@@H](O)C(C)(C)C |
| InChI | InChI=1S/C9H19NO2/c1-9(2,3)7(11)6-8(12)10(4)5/h7,11H,6H2,1-5H3/t7-/m1/s1 |
| InChIKey | HAUWRDZJRCZVGT-SSDOTTSWSA-N |
| XLogP | 0.87 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |