About CID 131974578
CID 131974578 (PubChem CID 131974578) has the molecular formula C24H36O6
and a molecular weight of 420.55 g/mol.
Molecular Properties
| Compound Name | CID 131974578 |
| PubChem CID | 131974578 |
| Molecular Formula | C24H36O6 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | — |
| SMILES | OC1[C@H]2OC3(CC4CCCCC4C3)O[C@H]2C(O)[C@@H]2OC3(CC4CCCCC4C3)O[C@@H]12 |
| InChI | InChI=1S/C24H36O6/c25-17-19-20(28-23(27-19)9-13-5-1-2-6-14(13)10-23)18(26)22-21(17)29-24(30-22)11-15-7-3-4-8-16(15)12-24/h13-22,25-26H,1-12H2/t13?,14?,15?,16?,17?,18?,19-,20-,21-,22+,23?,24?/m0/s1 |
| InChIKey | ANUVBPGWTDGOPA-DUDABTHHSA-N |
| XLogP | 2.88 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 131974578 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 131974578?
The IUPAC name of CID 131974578 (CID 131974578) is not available.
What is the SMILES notation for CID 131974578?
The canonical SMILES for CID 131974578 is OC1[C@H]2OC3(CC4CCCCC4C3)O[C@H]2C(O)[C@@H]2OC3(CC4CCCCC4C3)O[C@@H]12.
What is the InChIKey of CID 131974578?
The InChIKey is ANUVBPGWTDGOPA-DUDABTHHSA-N. The full InChI is InChI=1S/C24H36O6/c25-17-19-20(28-23(27-19)9-13-5-1-2-6-14(13)10-23)18(26)22-21(17)29-24(30-22)11-15-7-3-4-8-16(15)12-24/h13-22,25-26H,1-12H2/t13?,14?,15?,16?,17?,18?,19-,20-,21-,22+,23?,24?/m0/s1.
What are the key properties of CID 131974578?
CID 131974578 has a molecular weight of 420.55 g/mol, XLogP of 2.88, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 131974578 is sourced from PubChem (CID 131974578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).