C17H19N3O3 — CID 131975063
N-[(4-aminophenyl)methyl]-2-[(1S,5R,6R)-7,9-dioxo-8-azatricyclo[4.3.0.02,5]nonan-8-yl]acetamide (PubChem CID 131975063) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is N-[(4-aminophenyl)methyl]-2-[(1S,5R,6R)-7,9-dioxo-8-azatricyclo[4.3.0.02,5]nonan-8-yl]acetamide.
| Compound Name | N-[(4-aminophenyl)methyl]-2-[(1S,5R,6R)-7,9-dioxo-8-azatricyclo[4.3.0.02,5]nonan-8-yl]acetamide |
|---|---|
| PubChem CID | 131975063 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | N-[(4-aminophenyl)methyl]-2-[(1S,5R,6R)-7,9-dioxo-8-azatricyclo[4.3.0.02,5]nonan-8-yl]acetamide |
| SMILES | Nc1ccc(CNC(=O)CN2C(=O)[C@@H]3[C@@H]4CCC4[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C17H19N3O3/c18-10-3-1-9(2-4-10)7-19-13(21)8-20-16(22)14-11-5-6-12(11)15(14)17(20)23/h1-4,11-12,14-15H,5-8,18H2,(H,19,21)/t11-,12?,14-,15+/m1/s1 |
| InChIKey | YICSJEWCEIIEKH-IKKMQULASA-N |
| XLogP | 0.53 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|