C26H30F4N4O5S — CID 131975233
(2S)-4-(1-cyclopropylpyrazol-3-yl)-2-[2-fluoro-4-(6,6,6-trifluorohexoxy)phenyl]-2-methyl-N-methylsulfonyl-6-oxo-1,3-dihydropyridine-5-carboxamide (PubChem CID 131975233) has the molecular formula C26H30F4N4O5S and a molecular weight of 586.61 g/mol. Its IUPAC name is (2S)-4-(1-cyclopropylpyrazol-3-yl)-2-[2-fluoro-4-(6,6,6-trifluorohexoxy)phenyl]-2-methyl-N-methylsulfonyl-6-oxo-1,3-dihydropyridine-5-carboxamide.
| Compound Name | (2S)-4-(1-cyclopropylpyrazol-3-yl)-2-[2-fluoro-4-(6,6,6-trifluorohexoxy)phenyl]-2-methyl-N-methylsulfonyl-6-oxo-1,3-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 131975233 |
| Molecular Formula | C26H30F4N4O5S |
| Molecular Weight | 586.61 g/mol |
| Exact Mass | 586.19 |
| IUPAC Name | (2S)-4-(1-cyclopropylpyrazol-3-yl)-2-[2-fluoro-4-(6,6,6-trifluorohexoxy)phenyl]-2-methyl-N-methylsulfonyl-6-oxo-1,3-dihydropyridine-5-carboxamide |
| SMILES | C[C@@]1(c2ccc(OCCCCCC(F)(F)F)cc2F)CC(c2ccn(C3CC3)n2)=C(C(=O)NS(C)(=O)=O)C(=O)N1 |
| InChI | InChI=1S/C26H30F4N4O5S/c1-25(19-9-8-17(14-20(19)27)39-13-5-3-4-11-26(28,29)30)15-18(21-10-12-34(32-21)16-6-7-16)22(23(35)31-25)24(36)33-40(2,37)38/h8-10,12,14,16H,3-7,11,13,15H2,1-2H3,(H,31,35)(H,33,36)/t25-/m0/s1 |
| InChIKey | WVMJSYWQYIRVNS-VWLOTQADSA-N |
| XLogP | 4.12 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.61 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|