C26H28N2 — CID 131975391
6-tert-butyl-2-(2-methyl-2-quinolin-3-ylpropyl)quinoline (PubChem CID 131975391) has the molecular formula C26H28N2 and a molecular weight of 368.52 g/mol. Its IUPAC name is 6-tert-butyl-2-(2-methyl-2-quinolin-3-ylpropyl)quinoline.
| Compound Name | 6-tert-butyl-2-(2-methyl-2-quinolin-3-ylpropyl)quinoline |
|---|---|
| PubChem CID | 131975391 |
| Molecular Formula | C26H28N2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 6-tert-butyl-2-(2-methyl-2-quinolin-3-ylpropyl)quinoline |
| SMILES | CC(C)(C)c1ccc2nc(CC(C)(C)c3cnc4ccccc4c3)ccc2c1 |
| InChI | InChI=1S/C26H28N2/c1-25(2,3)20-11-13-24-19(14-20)10-12-22(28-24)16-26(4,5)21-15-18-8-6-7-9-23(18)27-17-21/h6-15,17H,16H2,1-5H3 |
| InChIKey | GAVVVEXUKQVAOB-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |