C41H40ClN5O8S2 — CID 131975867
5-[[2-(benzenesulfonyl)-4-[2-[[2-(4-chlorophenyl)phenyl]methylamino]ethylamino]benzoyl]sulfamoyl]-N-hydroxy-N-methyl-2-(2H-pyran-4-ylmethylamino)benzeneamine oxide (PubChem CID 131975867) has the molecular formula C41H40ClN5O8S2 and a molecular weight of 830.38 g/mol. Its IUPAC name is 5-[[2-(benzenesulfonyl)-4-[2-[[2-(4-chlorophenyl)phenyl]methylamino]ethylamino]benzoyl]sulfamoyl]-N-hydroxy-N-methyl-2-(2H-pyran-4-ylmethylamino)benzeneamine oxide.
| Compound Name | 5-[[2-(benzenesulfonyl)-4-[2-[[2-(4-chlorophenyl)phenyl]methylamino]ethylamino]benzoyl]sulfamoyl]-N-hydroxy-N-methyl-2-(2H-pyran-4-ylmethylamino)benzeneamine oxide |
|---|---|
| PubChem CID | 131975867 |
| Molecular Formula | C41H40ClN5O8S2 |
| Molecular Weight | 830.38 g/mol |
| Exact Mass | 829.20 |
| IUPAC Name | 5-[[2-(benzenesulfonyl)-4-[2-[[2-(4-chlorophenyl)phenyl]methylamino]ethylamino]benzoyl]sulfamoyl]-N-hydroxy-N-methyl-2-(2H-pyran-4-ylmethylamino)benzeneamine oxide |
| SMILES | C[N+]([O-])(O)c1cc(S(=O)(=O)NC(=O)c2ccc(NCCNCc3ccccc3-c3ccc(Cl)cc3)cc2S(=O)(=O)c2ccccc2)ccc1NCC1=CCOC=C1 |
| InChI | InChI=1S/C41H40ClN5O8S2/c1-47(49,50)39-26-35(16-18-38(39)45-27-29-19-23-55-24-20-29)57(53,54)46-41(48)37-17-15-33(25-40(37)56(51,52)34-8-3-2-4-9-34)44-22-21-43-28-31-7-5-6-10-36(31)30-11-13-32(42)14-12-30/h2-20,23,25-26,43-45,49H,21-22,24,27-28H2,1H3,(H,46,48) |
| InChIKey | QJHABOSMCHJKRH-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 185.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.38 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|