C11H19NO3S — CID 131976737
3-[[(2Z,4E)-5-methylhepta-2,4-dienylidene]amino]propane-1-sulfonic acid (PubChem CID 131976737) has the molecular formula C11H19NO3S and a molecular weight of 245.34 g/mol. Its IUPAC name is 3-[[(2Z,4E)-5-methylhepta-2,4-dienylidene]amino]propane-1-sulfonic acid.
| Compound Name | 3-[[(2Z,4E)-5-methylhepta-2,4-dienylidene]amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 131976737 |
| Molecular Formula | C11H19NO3S |
| Molecular Weight | 245.34 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 3-[[(2Z,4E)-5-methylhepta-2,4-dienylidene]amino]propane-1-sulfonic acid |
| SMILES | CC/C(C)=C/C=C\C=N\CCCS(=O)(=O)O |
| InChI | InChI=1S/C11H19NO3S/c1-3-11(2)7-4-5-8-12-9-6-10-16(13,14)15/h4-5,7-8H,3,6,9-10H2,1-2H3,(H,13,14,15)/b5-4-,11-7+,12-8+ |
| InChIKey | WRSCCWGBTGAXNZ-INBWHNMNSA-N |
| XLogP | 2.25 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|