C32H26O8 — CID 131976750
1-[6-(5-acetyl-1,6,7-trihydroxy-3-methylnaphthalen-2-yl)-2,3,5-trihydroxy-7-methylnaphthalen-1-yl]-2-phenylethanone (PubChem CID 131976750) has the molecular formula C32H26O8 and a molecular weight of 538.55 g/mol. Its IUPAC name is 1-[6-(5-acetyl-1,6,7-trihydroxy-3-methylnaphthalen-2-yl)-2,3,5-trihydroxy-7-methylnaphthalen-1-yl]-2-phenylethanone.
| Compound Name | 1-[6-(5-acetyl-1,6,7-trihydroxy-3-methylnaphthalen-2-yl)-2,3,5-trihydroxy-7-methylnaphthalen-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 131976750 |
| Molecular Formula | C32H26O8 |
| Molecular Weight | 538.55 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | 1-[6-(5-acetyl-1,6,7-trihydroxy-3-methylnaphthalen-2-yl)-2,3,5-trihydroxy-7-methylnaphthalen-1-yl]-2-phenylethanone |
| SMILES | CC(=O)c1c(O)c(O)cc2c(O)c(-c3c(C)cc4c(C(=O)Cc5ccccc5)c(O)c(O)cc4c3O)c(C)cc12 |
| InChI | InChI=1S/C32H26O8/c1-14-9-18-20(12-23(35)31(39)27(18)16(3)33)29(37)25(14)26-15(2)10-19-21(30(26)38)13-24(36)32(40)28(19)22(34)11-17-7-5-4-6-8-17/h4-10,12-13,35-40H,11H2,1-3H3 |
| InChIKey | YJFUHHUGQNYWCN-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.55 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|