C16H34O2 — CID 131976897
(1R,2R)-3-butyl-2,3-dimethyl-1-propan-2-yloxyheptan-1-ol (PubChem CID 131976897) has the molecular formula C16H34O2 and a molecular weight of 258.45 g/mol. Its IUPAC name is (1R,2R)-3-butyl-2,3-dimethyl-1-propan-2-yloxyheptan-1-ol.
| Compound Name | (1R,2R)-3-butyl-2,3-dimethyl-1-propan-2-yloxyheptan-1-ol |
|---|---|
| PubChem CID | 131976897 |
| Molecular Formula | C16H34O2 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.26 |
| IUPAC Name | (1R,2R)-3-butyl-2,3-dimethyl-1-propan-2-yloxyheptan-1-ol |
| SMILES | CCCCC(C)(CCCC)[C@@H](C)[C@H](O)OC(C)C |
| InChI | InChI=1S/C16H34O2/c1-7-9-11-16(6,12-10-8-2)14(5)15(17)18-13(3)4/h13-15,17H,7-12H2,1-6H3/t14-,15+/m0/s1 |
| InChIKey | ZMRUEMDSZTWKHO-LSDHHAIUSA-N |
| XLogP | 4.75 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|