About (1R,2R)-3-butyl-2,3-dimethyl-1-propan-2-yloxyheptan-1-ol
(1R,2R)-3-butyl-2,3-dimethyl-1-propan-2-yloxyheptan-1-ol (PubChem CID 131976897) has the molecular formula C16H34O2
and a molecular weight of 258.45 g/mol. Its IUPAC name is (1R,2R)-3-butyl-2,3-dimethyl-1-propan-2-yloxyheptan-1-ol.
Molecular Properties
| Compound Name | (1R,2R)-3-butyl-2,3-dimethyl-1-propan-2-yloxyheptan-1-ol |
| PubChem CID | 131976897 |
| Molecular Formula | C16H34O2 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.26 |
| IUPAC Name | (1R,2R)-3-butyl-2,3-dimethyl-1-propan-2-yloxyheptan-1-ol |
| SMILES | CCCCC(C)(CCCC)[C@@H](C)[C@H](O)OC(C)C |
| InChI | InChI=1S/C16H34O2/c1-7-9-11-16(6,12-10-8-2)14(5)15(17)18-13(3)4/h13-15,17H,7-12H2,1-6H3/t14-,15+/m0/s1 |
| InChIKey | ZMRUEMDSZTWKHO-LSDHHAIUSA-N |
| XLogP | 4.75 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (1R,2R)-3-butyl-2,3-dimethyl-1-propan-2-yloxyheptan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2R)-3-butyl-2,3-dimethyl-1-propan-2-yloxyheptan-1-ol?
The IUPAC name of (1R,2R)-3-butyl-2,3-dimethyl-1-propan-2-yloxyheptan-1-ol (CID 131976897) is (1R,2R)-3-butyl-2,3-dimethyl-1-propan-2-yloxyheptan-1-ol.
What is the SMILES notation for (1R,2R)-3-butyl-2,3-dimethyl-1-propan-2-yloxyheptan-1-ol?
The canonical SMILES for (1R,2R)-3-butyl-2,3-dimethyl-1-propan-2-yloxyheptan-1-ol is CCCCC(C)(CCCC)[C@@H](C)[C@H](O)OC(C)C.
What is the InChIKey of (1R,2R)-3-butyl-2,3-dimethyl-1-propan-2-yloxyheptan-1-ol?
The InChIKey is ZMRUEMDSZTWKHO-LSDHHAIUSA-N. The full InChI is InChI=1S/C16H34O2/c1-7-9-11-16(6,12-10-8-2)14(5)15(17)18-13(3)4/h13-15,17H,7-12H2,1-6H3/t14-,15+/m0/s1.
What are the key properties of (1R,2R)-3-butyl-2,3-dimethyl-1-propan-2-yloxyheptan-1-ol?
(1R,2R)-3-butyl-2,3-dimethyl-1-propan-2-yloxyheptan-1-ol has a molecular weight of 258.45 g/mol, XLogP of 4.75, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2R)-3-butyl-2,3-dimethyl-1-propan-2-yloxyheptan-1-ol is sourced from PubChem (CID 131976897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).