About 6-ethyl-1-propan-2-ylquinolin-1-ium-7,8-diol
6-ethyl-1-propan-2-ylquinolin-1-ium-7,8-diol (PubChem CID 131977064) has the molecular formula C14H18NO2+
and a molecular weight of 232.30 g/mol. Its IUPAC name is 6-ethyl-1-propan-2-ylquinolin-1-ium-7,8-diol.
Molecular Properties
| Compound Name | 6-ethyl-1-propan-2-ylquinolin-1-ium-7,8-diol |
| PubChem CID | 131977064 |
| Molecular Formula | C14H18NO2+ |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 6-ethyl-1-propan-2-ylquinolin-1-ium-7,8-diol |
| SMILES | CCc1cc2ccc[n+](C(C)C)c2c(O)c1O |
| InChI | InChI=1S/C14H17NO2/c1-4-10-8-11-6-5-7-15(9(2)3)12(11)14(17)13(10)16/h5-9,17H,4H2,1-3H3/p+1 |
| InChIKey | IATLUHCGENMKSO-UHFFFAOYSA-O |
| XLogP | 2.68 |
| TPSA | 44.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 6-ethyl-1-propan-2-ylquinolin-1-ium-7,8-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-1-propan-2-ylquinolin-1-ium-7,8-diol?
The IUPAC name of 6-ethyl-1-propan-2-ylquinolin-1-ium-7,8-diol (CID 131977064) is 6-ethyl-1-propan-2-ylquinolin-1-ium-7,8-diol.
What is the SMILES notation for 6-ethyl-1-propan-2-ylquinolin-1-ium-7,8-diol?
The canonical SMILES for 6-ethyl-1-propan-2-ylquinolin-1-ium-7,8-diol is CCc1cc2ccc[n+](C(C)C)c2c(O)c1O.
What is the InChIKey of 6-ethyl-1-propan-2-ylquinolin-1-ium-7,8-diol?
The InChIKey is IATLUHCGENMKSO-UHFFFAOYSA-O. The full InChI is InChI=1S/C14H17NO2/c1-4-10-8-11-6-5-7-15(9(2)3)12(11)14(17)13(10)16/h5-9,17H,4H2,1-3H3/p+1.
What are the key properties of 6-ethyl-1-propan-2-ylquinolin-1-ium-7,8-diol?
6-ethyl-1-propan-2-ylquinolin-1-ium-7,8-diol has a molecular weight of 232.30 g/mol, XLogP of 2.68, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-1-propan-2-ylquinolin-1-ium-7,8-diol is sourced from PubChem (CID 131977064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).