C24H40N4S2 — CID 131977805
1-[(3E,5Z)-2,4-dimethylhepta-1,3,5-trien-3-yl]-3-[5-[[(4Z)-2,4-dimethylhexa-2,4-dien-3-yl]carbamothioylamino]pentyl]thiourea (PubChem CID 131977805) has the molecular formula C24H40N4S2 and a molecular weight of 448.75 g/mol. Its IUPAC name is 1-[(3E,5Z)-2,4-dimethylhepta-1,3,5-trien-3-yl]-3-[5-[[(4Z)-2,4-dimethylhexa-2,4-dien-3-yl]carbamothioylamino]pentyl]thiourea.
| Compound Name | 1-[(3E,5Z)-2,4-dimethylhepta-1,3,5-trien-3-yl]-3-[5-[[(4Z)-2,4-dimethylhexa-2,4-dien-3-yl]carbamothioylamino]pentyl]thiourea |
|---|---|
| PubChem CID | 131977805 |
| Molecular Formula | C24H40N4S2 |
| Molecular Weight | 448.75 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | 1-[(3E,5Z)-2,4-dimethylhepta-1,3,5-trien-3-yl]-3-[5-[[(4Z)-2,4-dimethylhexa-2,4-dien-3-yl]carbamothioylamino]pentyl]thiourea |
| SMILES | C=C(C)/C(NC(=S)NCCCCCNC(=S)NC(=C(C)C)/C(C)=C\C)=C(C)\C=C/C |
| InChI | InChI=1S/C24H40N4S2/c1-9-14-20(8)22(18(5)6)28-24(30)26-16-13-11-12-15-25-23(29)27-21(17(3)4)19(7)10-2/h9-10,14H,5,11-13,15-16H2,1-4,6-8H3,(H2,25,27,29)(H2,26,28,30)/b14-9-,19-10-,22-20+ |
| InChIKey | MHKFSFCYSPZZHE-MMQUFJCDSA-N |
| XLogP | 5.77 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.75 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|