C45H64N4 — CID 131977883
N,N'-bis[6-[2,4,6-tri(propan-2-yl)phenyl]-2-pyridinyl]pentane-1,5-diamine (PubChem CID 131977883) has the molecular formula C45H64N4 and a molecular weight of 661.03 g/mol. Its IUPAC name is N,N'-bis[6-[2,4,6-tri(propan-2-yl)phenyl]-2-pyridinyl]pentane-1,5-diamine.
| Compound Name | N,N'-bis[6-[2,4,6-tri(propan-2-yl)phenyl]-2-pyridinyl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 131977883 |
| Molecular Formula | C45H64N4 |
| Molecular Weight | 661.03 g/mol |
| Exact Mass | 660.51 |
| IUPAC Name | N,N'-bis[6-[2,4,6-tri(propan-2-yl)phenyl]-2-pyridinyl]pentane-1,5-diamine |
| SMILES | CC(C)c1cc(C(C)C)c(-c2cccc(NCCCCCNc3cccc(-c4c(C(C)C)cc(C(C)C)cc4C(C)C)n3)n2)c(C(C)C)c1 |
| InChI | InChI=1S/C45H64N4/c1-28(2)34-24-36(30(5)6)44(37(25-34)31(7)8)40-18-16-20-42(48-40)46-22-14-13-15-23-47-43-21-17-19-41(49-43)45-38(32(9)10)26-35(29(3)4)27-39(45)33(11)12/h16-21,24-33H,13-15,22-23H2,1-12H3,(H,46,48)(H,47,49) |
| InChIKey | SSGUGNBJTULWRS-UHFFFAOYSA-N |
| XLogP | 13.25 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.03 |
| LogP ≤ 5 | 13.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|