C9H19NO2 — CID 131977898
(5R,6S)-5-ethyl-2,3-dimethyl-1,4-oxazepan-6-ol (PubChem CID 131977898) has the molecular formula C9H19NO2 and a molecular weight of 173.26 g/mol. Its IUPAC name is (5R,6S)-5-ethyl-2,3-dimethyl-1,4-oxazepan-6-ol.
| Compound Name | (5R,6S)-5-ethyl-2,3-dimethyl-1,4-oxazepan-6-ol |
|---|---|
| PubChem CID | 131977898 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | (5R,6S)-5-ethyl-2,3-dimethyl-1,4-oxazepan-6-ol |
| SMILES | CC[C@H]1NC(C)C(C)OC[C@H]1O |
| InChI | InChI=1S/C9H19NO2/c1-4-8-9(11)5-12-7(3)6(2)10-8/h6-11H,4-5H2,1-3H3/t6?,7?,8-,9-/m1/s1 |
| InChIKey | XHVPRKBDWRGFIU-GEPGNKONSA-N |
| XLogP | 0.52 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |