About 7-ethyl-5,6-di(propan-2-yl)-1,4-oxazepan-3-ol
7-ethyl-5,6-di(propan-2-yl)-1,4-oxazepan-3-ol (PubChem CID 131977997) has the molecular formula C13H27NO2
and a molecular weight of 229.36 g/mol. Its IUPAC name is 7-ethyl-5,6-di(propan-2-yl)-1,4-oxazepan-3-ol.
Molecular Properties
| Compound Name | 7-ethyl-5,6-di(propan-2-yl)-1,4-oxazepan-3-ol |
| PubChem CID | 131977997 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 7-ethyl-5,6-di(propan-2-yl)-1,4-oxazepan-3-ol |
| SMILES | CCC1OCC(O)NC(C(C)C)C1C(C)C |
| InChI | InChI=1S/C13H27NO2/c1-6-10-12(8(2)3)13(9(4)5)14-11(15)7-16-10/h8-15H,6-7H2,1-5H3 |
| InChIKey | CRRCKBBSYWOVFR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-ethyl-5,6-di(propan-2-yl)-1,4-oxazepan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-5,6-di(propan-2-yl)-1,4-oxazepan-3-ol?
The IUPAC name of 7-ethyl-5,6-di(propan-2-yl)-1,4-oxazepan-3-ol (CID 131977997) is 7-ethyl-5,6-di(propan-2-yl)-1,4-oxazepan-3-ol.
What is the SMILES notation for 7-ethyl-5,6-di(propan-2-yl)-1,4-oxazepan-3-ol?
The canonical SMILES for 7-ethyl-5,6-di(propan-2-yl)-1,4-oxazepan-3-ol is CCC1OCC(O)NC(C(C)C)C1C(C)C.
What is the InChIKey of 7-ethyl-5,6-di(propan-2-yl)-1,4-oxazepan-3-ol?
The InChIKey is CRRCKBBSYWOVFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO2/c1-6-10-12(8(2)3)13(9(4)5)14-11(15)7-16-10/h8-15H,6-7H2,1-5H3.
What are the key properties of 7-ethyl-5,6-di(propan-2-yl)-1,4-oxazepan-3-ol?
7-ethyl-5,6-di(propan-2-yl)-1,4-oxazepan-3-ol has a molecular weight of 229.36 g/mol, XLogP of 2.00, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-5,6-di(propan-2-yl)-1,4-oxazepan-3-ol is sourced from PubChem (CID 131977997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).