C14H23NO3S — CID 131978255
(E)-6-(4a-sulfanyl-3,5,7,7a-tetrahydro-2H-[1,4]dioxino[2,3-c]pyrrol-6-yl)-2,2-dimethylhex-4-en-3-one (PubChem CID 131978255) has the molecular formula C14H23NO3S and a molecular weight of 285.41 g/mol. Its IUPAC name is (E)-6-(4a-sulfanyl-3,5,7,7a-tetrahydro-2H-[1,4]dioxino[2,3-c]pyrrol-6-yl)-2,2-dimethylhex-4-en-3-one.
| Compound Name | (E)-6-(4a-sulfanyl-3,5,7,7a-tetrahydro-2H-[1,4]dioxino[2,3-c]pyrrol-6-yl)-2,2-dimethylhex-4-en-3-one |
|---|---|
| PubChem CID | 131978255 |
| Molecular Formula | C14H23NO3S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | (E)-6-(4a-sulfanyl-3,5,7,7a-tetrahydro-2H-[1,4]dioxino[2,3-c]pyrrol-6-yl)-2,2-dimethylhex-4-en-3-one |
| SMILES | CC(C)(C)C(=O)/C=C/CN1CC2OCCOC2(S)C1 |
| InChI | InChI=1S/C14H23NO3S/c1-13(2,3)11(16)5-4-6-15-9-12-14(19,10-15)18-8-7-17-12/h4-5,12,19H,6-10H2,1-3H3/b5-4+ |
| InChIKey | MHTSAYZOVZBRQE-SNAWJCMRSA-N |
| XLogP | 1.51 |
| TPSA | 38.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|