About (1E,3Z)-1-(methylideneamino)penta-1,3-diene-1-thiol
(1E,3Z)-1-(methylideneamino)penta-1,3-diene-1-thiol (PubChem CID 131978521) has the molecular formula C6H9NS
and a molecular weight of 127.21 g/mol. Its IUPAC name is (1E,3Z)-1-(methylideneamino)penta-1,3-diene-1-thiol.
Molecular Properties
| Compound Name | (1E,3Z)-1-(methylideneamino)penta-1,3-diene-1-thiol |
| PubChem CID | 131978521 |
| Molecular Formula | C6H9NS |
| Molecular Weight | 127.21 g/mol |
| Exact Mass | 127.05 |
| IUPAC Name | (1E,3Z)-1-(methylideneamino)penta-1,3-diene-1-thiol |
| SMILES | C=N/C(S)=C\C=C/C |
| InChI | InChI=1S/C6H9NS/c1-3-4-5-6(8)7-2/h3-5,8H,2H2,1H3/b4-3-,6-5+ |
| InChIKey | FUDYUPNYWCJMSB-DNVGVPOPSA-N |
| XLogP | 2.03 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (1E,3Z)-1-(methylideneamino)penta-1,3-diene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E,3Z)-1-(methylideneamino)penta-1,3-diene-1-thiol?
The IUPAC name of (1E,3Z)-1-(methylideneamino)penta-1,3-diene-1-thiol (CID 131978521) is (1E,3Z)-1-(methylideneamino)penta-1,3-diene-1-thiol.
What is the SMILES notation for (1E,3Z)-1-(methylideneamino)penta-1,3-diene-1-thiol?
The canonical SMILES for (1E,3Z)-1-(methylideneamino)penta-1,3-diene-1-thiol is C=N/C(S)=C\C=C/C.
What is the InChIKey of (1E,3Z)-1-(methylideneamino)penta-1,3-diene-1-thiol?
The InChIKey is FUDYUPNYWCJMSB-DNVGVPOPSA-N. The full InChI is InChI=1S/C6H9NS/c1-3-4-5-6(8)7-2/h3-5,8H,2H2,1H3/b4-3-,6-5+.
What are the key properties of (1E,3Z)-1-(methylideneamino)penta-1,3-diene-1-thiol?
(1E,3Z)-1-(methylideneamino)penta-1,3-diene-1-thiol has a molecular weight of 127.21 g/mol, XLogP of 2.03, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1E,3Z)-1-(methylideneamino)penta-1,3-diene-1-thiol is sourced from PubChem (CID 131978521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).