C31H30N4O3 — CID 131978534
[18-methoxy-19-[(4-pyrazol-1-ylphenyl)methoxy]-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4,6,8,16,18,20-heptaen-10-yl]methanol (PubChem CID 131978534) has the molecular formula C31H30N4O3 and a molecular weight of 506.61 g/mol. Its IUPAC name is [18-methoxy-19-[(4-pyrazol-1-ylphenyl)methoxy]-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4,6,8,16,18,20-heptaen-10-yl]methanol.
| Compound Name | [18-methoxy-19-[(4-pyrazol-1-ylphenyl)methoxy]-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4,6,8,16,18,20-heptaen-10-yl]methanol |
|---|---|
| PubChem CID | 131978534 |
| Molecular Formula | C31H30N4O3 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | [18-methoxy-19-[(4-pyrazol-1-ylphenyl)methoxy]-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4,6,8,16,18,20-heptaen-10-yl]methanol |
| SMILES | COc1cc2c(cc1OCc1ccc(-n3cccn3)cc1)C1Cc3c(n(CO)c4ccccc34)CN1CC2 |
| InChI | InChI=1S/C31H30N4O3/c1-37-30-15-22-11-14-33-18-29-26(24-5-2-3-6-27(24)34(29)20-36)16-28(33)25(22)17-31(30)38-19-21-7-9-23(10-8-21)35-13-4-12-32-35/h2-10,12-13,15,17,28,36H,11,14,16,18-20H2,1H3 |
| InChIKey | TVPQEPYHJCGXOW-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|