C37H33FN4O3 — CID 131978595
12-(4-fluorophenyl)-6,18-dimethoxy-19-[(4-pyrazol-1-ylphenyl)methoxy]-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaene (PubChem CID 131978595) has the molecular formula C37H33FN4O3 and a molecular weight of 600.69 g/mol. Its IUPAC name is 12-(4-fluorophenyl)-6,18-dimethoxy-19-[(4-pyrazol-1-ylphenyl)methoxy]-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaene.
| Compound Name | 12-(4-fluorophenyl)-6,18-dimethoxy-19-[(4-pyrazol-1-ylphenyl)methoxy]-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaene |
|---|---|
| PubChem CID | 131978595 |
| Molecular Formula | C37H33FN4O3 |
| Molecular Weight | 600.69 g/mol |
| Exact Mass | 600.25 |
| IUPAC Name | 12-(4-fluorophenyl)-6,18-dimethoxy-19-[(4-pyrazol-1-ylphenyl)methoxy]-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaene |
| SMILES | COc1ccc2[nH]c3c(c2c1)CC1c2cc(OCc4ccc(-n5cccn5)cc4)c(OC)cc2CCN1C3c1ccc(F)cc1 |
| InChI | InChI=1S/C37H33FN4O3/c1-43-28-12-13-32-30(19-28)31-20-33-29-21-35(45-22-23-4-10-27(11-5-23)42-16-3-15-39-42)34(44-2)18-25(29)14-17-41(33)37(36(31)40-32)24-6-8-26(38)9-7-24/h3-13,15-16,18-19,21,33,37,40H,14,17,20,22H2,1-2H3 |
| InChIKey | NXTYEOKDILYHIK-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 64.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.69 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|