C32H32N4O4 — CID 131978779
[6,19-dimethoxy-18-[(4-pyrazol-1-ylphenyl)methoxy]-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaen-10-yl]methanol (PubChem CID 131978779) has the molecular formula C32H32N4O4 and a molecular weight of 536.63 g/mol. Its IUPAC name is [6,19-dimethoxy-18-[(4-pyrazol-1-ylphenyl)methoxy]-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaen-10-yl]methanol.
| Compound Name | [6,19-dimethoxy-18-[(4-pyrazol-1-ylphenyl)methoxy]-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaen-10-yl]methanol |
|---|---|
| PubChem CID | 131978779 |
| Molecular Formula | C32H32N4O4 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | [6,19-dimethoxy-18-[(4-pyrazol-1-ylphenyl)methoxy]-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaen-10-yl]methanol |
| SMILES | COc1ccc2c(c1)c1c(n2CO)CN2CCc3cc(OCc4ccc(-n5cccn5)cc4)c(OC)cc3C2C1 |
| InChI | InChI=1S/C32H32N4O4/c1-38-24-8-9-28-26(15-24)27-16-29-25-17-31(39-2)32(14-22(25)10-13-34(29)18-30(27)35(28)20-37)40-19-21-4-6-23(7-5-21)36-12-3-11-33-36/h3-9,11-12,14-15,17,29,37H,10,13,16,18-20H2,1-2H3 |
| InChIKey | XJLONNIEYVMEAC-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|