C13H20O — CID 131979023
(5Z,7Z)-3,3,7-trimethyl-4-methylidenenona-5,7-dienal (PubChem CID 131979023) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is (5Z,7Z)-3,3,7-trimethyl-4-methylidenenona-5,7-dienal.
| Compound Name | (5Z,7Z)-3,3,7-trimethyl-4-methylidenenona-5,7-dienal |
|---|---|
| PubChem CID | 131979023 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | (5Z,7Z)-3,3,7-trimethyl-4-methylidenenona-5,7-dienal |
| SMILES | C=C(/C=C\C(C)=C/C)C(C)(C)CC=O |
| InChI | InChI=1S/C13H20O/c1-6-11(2)7-8-12(3)13(4,5)9-10-14/h6-8,10H,3,9H2,1-2,4-5H3/b8-7-,11-6- |
| InChIKey | TUADCVTWBIASAS-QHLNICISSA-N |
| XLogP | 3.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|