C25H30O4 — CID 131979047
(2Z,4E)-5-[(1R,4S)-4-[3-(4-methoxyphenyl)prop-2-ynoxy]-2,6,6-trimethylcyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid (PubChem CID 131979047) has the molecular formula C25H30O4 and a molecular weight of 394.51 g/mol. Its IUPAC name is (2Z,4E)-5-[(1R,4S)-4-[3-(4-methoxyphenyl)prop-2-ynoxy]-2,6,6-trimethylcyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid.
| Compound Name | (2Z,4E)-5-[(1R,4S)-4-[3-(4-methoxyphenyl)prop-2-ynoxy]-2,6,6-trimethylcyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 131979047 |
| Molecular Formula | C25H30O4 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | (2Z,4E)-5-[(1R,4S)-4-[3-(4-methoxyphenyl)prop-2-ynoxy]-2,6,6-trimethylcyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid |
| SMILES | COc1ccc(C#CCO[C@@H]2C=C(C)[C@H](/C=C/C(C)=C\C(=O)O)C(C)(C)C2)cc1 |
| InChI | InChI=1S/C25H30O4/c1-18(15-24(26)27)8-13-23-19(2)16-22(17-25(23,3)4)29-14-6-7-20-9-11-21(28-5)12-10-20/h8-13,15-16,22-23H,14,17H2,1-5H3,(H,26,27)/b13-8+,18-15-/t22-,23+/m1/s1 |
| InChIKey | VRHGYUKCDUVFPP-ZREPHRGNSA-N |
| XLogP | 5.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|