About 2-(2-methylpropyl)-2,3-dihydropyran-4-one
2-(2-methylpropyl)-2,3-dihydropyran-4-one (PubChem CID 13197913) has the molecular formula C9H14O2
and a molecular weight of 154.21 g/mol. Its IUPAC name is 2-(2-methylpropyl)-2,3-dihydropyran-4-one.
Molecular Properties
| Compound Name | 2-(2-methylpropyl)-2,3-dihydropyran-4-one |
| PubChem CID | 13197913 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 2-(2-methylpropyl)-2,3-dihydropyran-4-one |
| SMILES | CC(C)CC1CC(=O)C=CO1 |
| InChI | InChI=1S/C9H14O2/c1-7(2)5-9-6-8(10)3-4-11-9/h3-4,7,9H,5-6H2,1-2H3 |
| InChIKey | UAQPPGDUCYGKGR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-methylpropyl)-2,3-dihydropyran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylpropyl)-2,3-dihydropyran-4-one?
The IUPAC name of 2-(2-methylpropyl)-2,3-dihydropyran-4-one (CID 13197913) is 2-(2-methylpropyl)-2,3-dihydropyran-4-one.
What is the SMILES notation for 2-(2-methylpropyl)-2,3-dihydropyran-4-one?
The canonical SMILES for 2-(2-methylpropyl)-2,3-dihydropyran-4-one is CC(C)CC1CC(=O)C=CO1.
What is the InChIKey of 2-(2-methylpropyl)-2,3-dihydropyran-4-one?
The InChIKey is UAQPPGDUCYGKGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2/c1-7(2)5-9-6-8(10)3-4-11-9/h3-4,7,9H,5-6H2,1-2H3.
What are the key properties of 2-(2-methylpropyl)-2,3-dihydropyran-4-one?
2-(2-methylpropyl)-2,3-dihydropyran-4-one has a molecular weight of 154.21 g/mol, XLogP of 1.90, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylpropyl)-2,3-dihydropyran-4-one is sourced from PubChem (CID 13197913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).