C13H19NO — CID 131980321
(1E,4E,5Z)-1-(dimethylamino)-4-ethylidene-2-methylocta-1,5,7-trien-3-one (PubChem CID 131980321) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is (1E,4E,5Z)-1-(dimethylamino)-4-ethylidene-2-methylocta-1,5,7-trien-3-one.
| Compound Name | (1E,4E,5Z)-1-(dimethylamino)-4-ethylidene-2-methylocta-1,5,7-trien-3-one |
|---|---|
| PubChem CID | 131980321 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | (1E,4E,5Z)-1-(dimethylamino)-4-ethylidene-2-methylocta-1,5,7-trien-3-one |
| SMILES | C=C/C=C\C(=C/C)C(=O)/C(C)=C/N(C)C |
| InChI | InChI=1S/C13H19NO/c1-6-8-9-12(7-2)13(15)11(3)10-14(4)5/h6-10H,1H2,2-5H3/b9-8-,11-10+,12-7+ |
| InChIKey | MDDODCACICVGGA-WEPCECPMSA-N |
| XLogP | 2.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|