About (2E,3Z)-1-methyl-2,3-bis(prop-2-enylidene)pyrrole
(2E,3Z)-1-methyl-2,3-bis(prop-2-enylidene)pyrrole (PubChem CID 131980533) has the molecular formula C11H13N
and a molecular weight of 159.23 g/mol. Its IUPAC name is (2E,3Z)-1-methyl-2,3-bis(prop-2-enylidene)pyrrole.
Molecular Properties
| Compound Name | (2E,3Z)-1-methyl-2,3-bis(prop-2-enylidene)pyrrole |
| PubChem CID | 131980533 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | (2E,3Z)-1-methyl-2,3-bis(prop-2-enylidene)pyrrole |
| SMILES | C=C/C=c1/ccn(C)/c1=C/C=C |
| InChI | InChI=1S/C11H13N/c1-4-6-10-8-9-12(3)11(10)7-5-2/h4-9H,1-2H2,3H3/b10-6-,11-7+ |
| InChIKey | ZOUAXHWMZZTAIQ-NAKBGQTNSA-N |
| XLogP | 0.96 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2E,3Z)-1-methyl-2,3-bis(prop-2-enylidene)pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,3Z)-1-methyl-2,3-bis(prop-2-enylidene)pyrrole?
The IUPAC name of (2E,3Z)-1-methyl-2,3-bis(prop-2-enylidene)pyrrole (CID 131980533) is (2E,3Z)-1-methyl-2,3-bis(prop-2-enylidene)pyrrole.
What is the SMILES notation for (2E,3Z)-1-methyl-2,3-bis(prop-2-enylidene)pyrrole?
The canonical SMILES for (2E,3Z)-1-methyl-2,3-bis(prop-2-enylidene)pyrrole is C=C/C=c1/ccn(C)/c1=C/C=C.
What is the InChIKey of (2E,3Z)-1-methyl-2,3-bis(prop-2-enylidene)pyrrole?
The InChIKey is ZOUAXHWMZZTAIQ-NAKBGQTNSA-N. The full InChI is InChI=1S/C11H13N/c1-4-6-10-8-9-12(3)11(10)7-5-2/h4-9H,1-2H2,3H3/b10-6-,11-7+.
What are the key properties of (2E,3Z)-1-methyl-2,3-bis(prop-2-enylidene)pyrrole?
(2E,3Z)-1-methyl-2,3-bis(prop-2-enylidene)pyrrole has a molecular weight of 159.23 g/mol, XLogP of 0.96, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,3Z)-1-methyl-2,3-bis(prop-2-enylidene)pyrrole is sourced from PubChem (CID 131980533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).