About [(3Z,5Z)-hepta-3,5-dien-3-yl]hydrazine
[(3Z,5Z)-hepta-3,5-dien-3-yl]hydrazine (PubChem CID 131980589) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is [(3Z,5Z)-hepta-3,5-dien-3-yl]hydrazine.
Molecular Properties
| Compound Name | [(3Z,5Z)-hepta-3,5-dien-3-yl]hydrazine |
| PubChem CID | 131980589 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | [(3Z,5Z)-hepta-3,5-dien-3-yl]hydrazine |
| SMILES | C/C=C\C=C(\CC)NN |
| InChI | InChI=1S/C7H14N2/c1-3-5-6-7(4-2)9-8/h3,5-6,9H,4,8H2,1-2H3/b5-3-,7-6- |
| InChIKey | DTUYIRREOKOVFM-VKLRWAGZSA-N |
| XLogP | 1.32 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(3Z,5Z)-hepta-3,5-dien-3-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3Z,5Z)-hepta-3,5-dien-3-yl]hydrazine?
The IUPAC name of [(3Z,5Z)-hepta-3,5-dien-3-yl]hydrazine (CID 131980589) is [(3Z,5Z)-hepta-3,5-dien-3-yl]hydrazine.
What is the SMILES notation for [(3Z,5Z)-hepta-3,5-dien-3-yl]hydrazine?
The canonical SMILES for [(3Z,5Z)-hepta-3,5-dien-3-yl]hydrazine is C/C=C\C=C(\CC)NN.
What is the InChIKey of [(3Z,5Z)-hepta-3,5-dien-3-yl]hydrazine?
The InChIKey is DTUYIRREOKOVFM-VKLRWAGZSA-N. The full InChI is InChI=1S/C7H14N2/c1-3-5-6-7(4-2)9-8/h3,5-6,9H,4,8H2,1-2H3/b5-3-,7-6-.
What are the key properties of [(3Z,5Z)-hepta-3,5-dien-3-yl]hydrazine?
[(3Z,5Z)-hepta-3,5-dien-3-yl]hydrazine has a molecular weight of 126.20 g/mol, XLogP of 1.32, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3Z,5Z)-hepta-3,5-dien-3-yl]hydrazine is sourced from PubChem (CID 131980589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).