About 5-cyclopropyl-4-[(3,4-dimethylphenoxy)methyl]-2-fluorobenzamide
5-cyclopropyl-4-[(3,4-dimethylphenoxy)methyl]-2-fluorobenzamide (PubChem CID 131980752) has the molecular formula C19H20FNO2
and a molecular weight of 313.37 g/mol. Its IUPAC name is 5-cyclopropyl-4-[(3,4-dimethylphenoxy)methyl]-2-fluorobenzamide.
Molecular Properties
| Compound Name | 5-cyclopropyl-4-[(3,4-dimethylphenoxy)methyl]-2-fluorobenzamide |
| PubChem CID | 131980752 |
| Molecular Formula | C19H20FNO2 |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 5-cyclopropyl-4-[(3,4-dimethylphenoxy)methyl]-2-fluorobenzamide |
| SMILES | Cc1ccc(OCc2cc(F)c(C(N)=O)cc2C2CC2)cc1C |
| InChI | InChI=1S/C19H20FNO2/c1-11-3-6-15(7-12(11)2)23-10-14-8-18(20)17(19(21)22)9-16(14)13-4-5-13/h3,6-9,13H,4-5,10H2,1-2H3,(H2,21,22) |
| InChIKey | JHGUYPXQGHXSMG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-cyclopropyl-4-[(3,4-dimethylphenoxy)methyl]-2-fluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopropyl-4-[(3,4-dimethylphenoxy)methyl]-2-fluorobenzamide?
The IUPAC name of 5-cyclopropyl-4-[(3,4-dimethylphenoxy)methyl]-2-fluorobenzamide (CID 131980752) is 5-cyclopropyl-4-[(3,4-dimethylphenoxy)methyl]-2-fluorobenzamide.
What is the SMILES notation for 5-cyclopropyl-4-[(3,4-dimethylphenoxy)methyl]-2-fluorobenzamide?
The canonical SMILES for 5-cyclopropyl-4-[(3,4-dimethylphenoxy)methyl]-2-fluorobenzamide is Cc1ccc(OCc2cc(F)c(C(N)=O)cc2C2CC2)cc1C.
What is the InChIKey of 5-cyclopropyl-4-[(3,4-dimethylphenoxy)methyl]-2-fluorobenzamide?
The InChIKey is JHGUYPXQGHXSMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20FNO2/c1-11-3-6-15(7-12(11)2)23-10-14-8-18(20)17(19(21)22)9-16(14)13-4-5-13/h3,6-9,13H,4-5,10H2,1-2H3,(H2,21,22).
What are the key properties of 5-cyclopropyl-4-[(3,4-dimethylphenoxy)methyl]-2-fluorobenzamide?
5-cyclopropyl-4-[(3,4-dimethylphenoxy)methyl]-2-fluorobenzamide has a molecular weight of 313.37 g/mol, XLogP of 4.00, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopropyl-4-[(3,4-dimethylphenoxy)methyl]-2-fluorobenzamide is sourced from PubChem (CID 131980752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).