C18H37P — CID 131981008
[1-(5-ethyl-2,2,4,4,6-pentamethylcyclohexyl)-3-methylbutan-2-yl]phosphane (PubChem CID 131981008) has the molecular formula C18H37P and a molecular weight of 284.47 g/mol. Its IUPAC name is [1-(5-ethyl-2,2,4,4,6-pentamethylcyclohexyl)-3-methylbutan-2-yl]phosphane.
| Compound Name | [1-(5-ethyl-2,2,4,4,6-pentamethylcyclohexyl)-3-methylbutan-2-yl]phosphane |
|---|---|
| PubChem CID | 131981008 |
| Molecular Formula | C18H37P |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.26 |
| IUPAC Name | [1-(5-ethyl-2,2,4,4,6-pentamethylcyclohexyl)-3-methylbutan-2-yl]phosphane |
| SMILES | CCC1C(C)C(CC(P)C(C)C)C(C)(C)CC1(C)C |
| InChI | InChI=1S/C18H37P/c1-9-14-13(4)15(10-16(19)12(2)3)18(7,8)11-17(14,5)6/h12-16H,9-11,19H2,1-8H3 |
| InChIKey | QMKDPWVFRHRVRW-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|