About (3Z,5E)-5-(propan-2-ylamino)hepta-3,5-diene-2-thiol
(3Z,5E)-5-(propan-2-ylamino)hepta-3,5-diene-2-thiol (PubChem CID 131981081) has the molecular formula C10H19NS
and a molecular weight of 185.34 g/mol. Its IUPAC name is (3Z,5E)-5-(propan-2-ylamino)hepta-3,5-diene-2-thiol.
Molecular Properties
| Compound Name | (3Z,5E)-5-(propan-2-ylamino)hepta-3,5-diene-2-thiol |
| PubChem CID | 131981081 |
| Molecular Formula | C10H19NS |
| Molecular Weight | 185.34 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | (3Z,5E)-5-(propan-2-ylamino)hepta-3,5-diene-2-thiol |
| SMILES | C/C=C(\C=C/C(C)S)NC(C)C |
| InChI | InChI=1S/C10H19NS/c1-5-10(11-8(2)3)7-6-9(4)12/h5-9,11-12H,1-4H3/b7-6-,10-5+ |
| InChIKey | YXNVLASRGMOVAP-JQEGGOPCSA-N |
| XLogP | 2.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3Z,5E)-5-(propan-2-ylamino)hepta-3,5-diene-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5E)-5-(propan-2-ylamino)hepta-3,5-diene-2-thiol?
The IUPAC name of (3Z,5E)-5-(propan-2-ylamino)hepta-3,5-diene-2-thiol (CID 131981081) is (3Z,5E)-5-(propan-2-ylamino)hepta-3,5-diene-2-thiol.
What is the SMILES notation for (3Z,5E)-5-(propan-2-ylamino)hepta-3,5-diene-2-thiol?
The canonical SMILES for (3Z,5E)-5-(propan-2-ylamino)hepta-3,5-diene-2-thiol is C/C=C(\C=C/C(C)S)NC(C)C.
What is the InChIKey of (3Z,5E)-5-(propan-2-ylamino)hepta-3,5-diene-2-thiol?
The InChIKey is YXNVLASRGMOVAP-JQEGGOPCSA-N. The full InChI is InChI=1S/C10H19NS/c1-5-10(11-8(2)3)7-6-9(4)12/h5-9,11-12H,1-4H3/b7-6-,10-5+.
What are the key properties of (3Z,5E)-5-(propan-2-ylamino)hepta-3,5-diene-2-thiol?
(3Z,5E)-5-(propan-2-ylamino)hepta-3,5-diene-2-thiol has a molecular weight of 185.34 g/mol, XLogP of 2.76, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5E)-5-(propan-2-ylamino)hepta-3,5-diene-2-thiol is sourced from PubChem (CID 131981081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).