C7H10O5 — CID 131981236
(3R,3aR,6S,6aS)-2,3,6-trihydroxy-2,3,3a,4,6,6a-hexahydrocyclopenta[b]furan-5-one (PubChem CID 131981236) has the molecular formula C7H10O5 and a molecular weight of 174.15 g/mol. Its IUPAC name is (3R,3aR,6S,6aS)-2,3,6-trihydroxy-2,3,3a,4,6,6a-hexahydrocyclopenta[b]furan-5-one.
| Compound Name | (3R,3aR,6S,6aS)-2,3,6-trihydroxy-2,3,3a,4,6,6a-hexahydrocyclopenta[b]furan-5-one |
|---|---|
| PubChem CID | 131981236 |
| Molecular Formula | C7H10O5 |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | (3R,3aR,6S,6aS)-2,3,6-trihydroxy-2,3,3a,4,6,6a-hexahydrocyclopenta[b]furan-5-one |
| SMILES | O=C1C[C@H]2[C@H](OC(O)[C@@H]2O)[C@@H]1O |
| InChI | InChI=1S/C7H10O5/c8-3-1-2-4(9)7(11)12-6(2)5(3)10/h2,4-7,9-11H,1H2/t2-,4-,5-,6+,7?/m1/s1 |
| InChIKey | JEVAXNVSLNDRFA-AGXVVOIWSA-N |
| XLogP | -1.99 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |