C25H25F6N5 — CID 131981270
2-[6-[3-(trifluoromethyl)-4-[2-[4-(trifluoromethyl)phenyl]ethyl]phenyl]-1,4-dihydropyrimidin-2-yl]pyrrolidine-1-carboximidamide (PubChem CID 131981270) has the molecular formula C25H25F6N5 and a molecular weight of 509.50 g/mol. Its IUPAC name is 2-[6-[3-(trifluoromethyl)-4-[2-[4-(trifluoromethyl)phenyl]ethyl]phenyl]-1,4-dihydropyrimidin-2-yl]pyrrolidine-1-carboximidamide.
| Compound Name | 2-[6-[3-(trifluoromethyl)-4-[2-[4-(trifluoromethyl)phenyl]ethyl]phenyl]-1,4-dihydropyrimidin-2-yl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 131981270 |
| Molecular Formula | C25H25F6N5 |
| Molecular Weight | 509.50 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | 2-[6-[3-(trifluoromethyl)-4-[2-[4-(trifluoromethyl)phenyl]ethyl]phenyl]-1,4-dihydropyrimidin-2-yl]pyrrolidine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CCCC1C1=NCC=C(c2ccc(CCc3ccc(C(F)(F)F)cc3)c(C(F)(F)F)c2)N1 |
| InChI | InChI=1S/C25H25F6N5/c26-24(27,28)18-9-4-15(5-10-18)3-6-16-7-8-17(14-19(16)25(29,30)31)20-11-12-34-22(35-20)21-2-1-13-36(21)23(32)33/h4-5,7-11,14,21H,1-3,6,12-13H2,(H3,32,33)(H,34,35) |
| InChIKey | OIWLYENJWGNFET-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.50 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|