C28H40F3N3O3 — CID 131981319
tert-butyl (2S)-2-[3-[4-octyl-3-(2,2,2-trifluoroethyl)phenyl]-6H-1,2,4-oxadiazin-5-yl]pyrrolidine-1-carboxylate (PubChem CID 131981319) has the molecular formula C28H40F3N3O3 and a molecular weight of 523.64 g/mol. Its IUPAC name is tert-butyl (2S)-2-[3-[4-octyl-3-(2,2,2-trifluoroethyl)phenyl]-6H-1,2,4-oxadiazin-5-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[3-[4-octyl-3-(2,2,2-trifluoroethyl)phenyl]-6H-1,2,4-oxadiazin-5-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 131981319 |
| Molecular Formula | C28H40F3N3O3 |
| Molecular Weight | 523.64 g/mol |
| Exact Mass | 523.30 |
| IUPAC Name | tert-butyl (2S)-2-[3-[4-octyl-3-(2,2,2-trifluoroethyl)phenyl]-6H-1,2,4-oxadiazin-5-yl]pyrrolidine-1-carboxylate |
| SMILES | CCCCCCCCc1ccc(C2=NOCC([C@@H]3CCCN3C(=O)OC(C)(C)C)=N2)cc1CC(F)(F)F |
| InChI | InChI=1S/C28H40F3N3O3/c1-5-6-7-8-9-10-12-20-14-15-21(17-22(20)18-28(29,30)31)25-32-23(19-36-33-25)24-13-11-16-34(24)26(35)37-27(2,3)4/h14-15,17,24H,5-13,16,18-19H2,1-4H3/t24-/m0/s1 |
| InChIKey | BTGDUEKDPQQWHD-DEOSSOPVSA-N |
| XLogP | 7.23 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.64 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|