C21H29F3N4O — CID 131981431
3-[4-octoxy-3-(trifluoromethyl)phenyl]-5-pyrrolidin-2-yl-1H-1,2,4-triazole (PubChem CID 131981431) has the molecular formula C21H29F3N4O and a molecular weight of 410.48 g/mol. Its IUPAC name is 3-[4-octoxy-3-(trifluoromethyl)phenyl]-5-pyrrolidin-2-yl-1H-1,2,4-triazole.
| Compound Name | 3-[4-octoxy-3-(trifluoromethyl)phenyl]-5-pyrrolidin-2-yl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 131981431 |
| Molecular Formula | C21H29F3N4O |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 3-[4-octoxy-3-(trifluoromethyl)phenyl]-5-pyrrolidin-2-yl-1H-1,2,4-triazole |
| SMILES | CCCCCCCCOc1ccc(-c2n[nH]c(C3CCCN3)n2)cc1C(F)(F)F |
| InChI | InChI=1S/C21H29F3N4O/c1-2-3-4-5-6-7-13-29-18-11-10-15(14-16(18)21(22,23)24)19-26-20(28-27-19)17-9-8-12-25-17/h10-11,14,17,25H,2-9,12-13H2,1H3,(H,26,27,28) |
| InChIKey | QMUNQVRBWVUEHA-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|