C24H26F3N5O — CID 131981472
(2S)-2-[4-[4-[2-(4-ethylphenyl)ethyl]-3-(trifluoromethyl)phenyl]-1-oxido-1,3-diazet-1-ium-2-yl]pyrrolidine-1-carboximidamide (PubChem CID 131981472) has the molecular formula C24H26F3N5O and a molecular weight of 457.50 g/mol. Its IUPAC name is (2S)-2-[4-[4-[2-(4-ethylphenyl)ethyl]-3-(trifluoromethyl)phenyl]-1-oxido-1,3-diazet-1-ium-2-yl]pyrrolidine-1-carboximidamide.
| Compound Name | (2S)-2-[4-[4-[2-(4-ethylphenyl)ethyl]-3-(trifluoromethyl)phenyl]-1-oxido-1,3-diazet-1-ium-2-yl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 131981472 |
| Molecular Formula | C24H26F3N5O |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | (2S)-2-[4-[4-[2-(4-ethylphenyl)ethyl]-3-(trifluoromethyl)phenyl]-1-oxido-1,3-diazet-1-ium-2-yl]pyrrolidine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CCC[C@H]1C1=[N+]([O-])C(c2ccc(CCc3ccc(CC)cc3)c(C(F)(F)F)c2)=N1 |
| InChI | InChI=1S/C24H26F3N5O/c1-2-15-5-7-16(8-6-15)9-10-17-11-12-18(14-19(17)24(25,26)27)21-30-22(32(21)33)20-4-3-13-31(20)23(28)29/h5-8,11-12,14,20H,2-4,9-10,13H2,1H3,(H3,28,29)/t20-/m0/s1 |
| InChIKey | VDKNMFFOUMAJND-FQEVSTJZSA-N |
| XLogP | 4.08 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|