C24H24F3N5O2S — CID 131981936
5,5-dimethyl-1-[(E)-2-[(Z)-2-(methylideneamino)-2-(pyridin-2-ylamino)ethenyl]but-2-enyl]-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidine-2,4-dione (PubChem CID 131981936) has the molecular formula C24H24F3N5O2S and a molecular weight of 503.55 g/mol. Its IUPAC name is 5,5-dimethyl-1-[(E)-2-[(Z)-2-(methylideneamino)-2-(pyridin-2-ylamino)ethenyl]but-2-enyl]-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-1-[(E)-2-[(Z)-2-(methylideneamino)-2-(pyridin-2-ylamino)ethenyl]but-2-enyl]-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 131981936 |
| Molecular Formula | C24H24F3N5O2S |
| Molecular Weight | 503.55 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | 5,5-dimethyl-1-[(E)-2-[(Z)-2-(methylideneamino)-2-(pyridin-2-ylamino)ethenyl]but-2-enyl]-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidine-2,4-dione |
| SMILES | C=N/C(=C\C(=C/C)CN1C(=O)N(c2ccc(SC(F)(F)F)cc2)C(=O)C1(C)C)Nc1ccccn1 |
| InChI | InChI=1S/C24H24F3N5O2S/c1-5-16(14-20(28-4)30-19-8-6-7-13-29-19)15-31-22(34)32(21(33)23(31,2)3)17-9-11-18(12-10-17)35-24(25,26)27/h5-14H,4,15H2,1-3H3,(H,29,30)/b16-5+,20-14+ |
| InChIKey | HUFCLBKYSGUYBS-AHPOASFGSA-N |
| XLogP | 5.84 |
| TPSA | 77.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.55 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|