C13H16S — CID 131982212
3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2,5-dimethylthiophene (PubChem CID 131982212) has the molecular formula C13H16S and a molecular weight of 204.34 g/mol. Its IUPAC name is 3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2,5-dimethylthiophene.
| Compound Name | 3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2,5-dimethylthiophene |
|---|---|
| PubChem CID | 131982212 |
| Molecular Formula | C13H16S |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2,5-dimethylthiophene |
| SMILES | C=C/C=C\C(=C/C)c1cc(C)sc1C |
| InChI | InChI=1S/C13H16S/c1-5-7-8-12(6-2)13-9-10(3)14-11(13)4/h5-9H,1H2,2-4H3/b8-7-,12-6+ |
| InChIKey | MIWYQHBLVMWOBB-HRZQEMGZSA-N |
| XLogP | 4.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|