C6H4BrF9O — CID 13198227
2-bromo-3,3,4,4,5,5,6,6,6-nonafluorohexan-1-ol (PubChem CID 13198227) has the molecular formula C6H4BrF9O and a molecular weight of 342.98 g/mol. Its IUPAC name is 2-bromo-3,3,4,4,5,5,6,6,6-nonafluorohexan-1-ol.
| Compound Name | 2-bromo-3,3,4,4,5,5,6,6,6-nonafluorohexan-1-ol |
|---|---|
| PubChem CID | 13198227 |
| Molecular Formula | C6H4BrF9O |
| Molecular Weight | 342.98 g/mol |
| Exact Mass | 341.93 |
| IUPAC Name | 2-bromo-3,3,4,4,5,5,6,6,6-nonafluorohexan-1-ol |
| SMILES | OCC(Br)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H4BrF9O/c7-2(1-17)3(8,9)4(10,11)5(12,13)6(14,15)16/h2,17H,1H2 |
| InChIKey | XIZZECGIOVVYHB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.98 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|