About 4-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-3-yl)-3-methylbenzonitrile
4-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-3-yl)-3-methylbenzonitrile (PubChem CID 131982530) has the molecular formula C14H13N3
and a molecular weight of 223.28 g/mol. Its IUPAC name is 4-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-3-yl)-3-methylbenzonitrile.
Molecular Properties
| Compound Name | 4-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-3-yl)-3-methylbenzonitrile |
| PubChem CID | 131982530 |
| Molecular Formula | C14H13N3 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 4-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-3-yl)-3-methylbenzonitrile |
| SMILES | Cc1cc(C#N)ccc1-c1cnn2c1CCC2 |
| InChI | InChI=1S/C14H13N3/c1-10-7-11(8-15)4-5-12(10)13-9-16-17-6-2-3-14(13)17/h4-5,7,9H,2-3,6H2,1H3 |
| InChIKey | OGDGVHQEADTPKS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-3-yl)-3-methylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-3-yl)-3-methylbenzonitrile?
The IUPAC name of 4-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-3-yl)-3-methylbenzonitrile (CID 131982530) is 4-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-3-yl)-3-methylbenzonitrile.
What is the SMILES notation for 4-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-3-yl)-3-methylbenzonitrile?
The canonical SMILES for 4-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-3-yl)-3-methylbenzonitrile is Cc1cc(C#N)ccc1-c1cnn2c1CCC2.
What is the InChIKey of 4-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-3-yl)-3-methylbenzonitrile?
The InChIKey is OGDGVHQEADTPKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3/c1-10-7-11(8-15)4-5-12(10)13-9-16-17-6-2-3-14(13)17/h4-5,7,9H,2-3,6H2,1H3.
What are the key properties of 4-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-3-yl)-3-methylbenzonitrile?
4-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-3-yl)-3-methylbenzonitrile has a molecular weight of 223.28 g/mol, XLogP of 2.68, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-3-yl)-3-methylbenzonitrile is sourced from PubChem (CID 131982530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).