C33H30F3NO — CID 131982590
N-[5,5-bis(4-fluorophenyl)-2-methyl-1-(4-prop-2-enoxyphenyl)pent-4-enyl]-4-fluoroaniline (PubChem CID 131982590) has the molecular formula C33H30F3NO and a molecular weight of 513.60 g/mol. Its IUPAC name is N-[5,5-bis(4-fluorophenyl)-2-methyl-1-(4-prop-2-enoxyphenyl)pent-4-enyl]-4-fluoroaniline.
| Compound Name | N-[5,5-bis(4-fluorophenyl)-2-methyl-1-(4-prop-2-enoxyphenyl)pent-4-enyl]-4-fluoroaniline |
|---|---|
| PubChem CID | 131982590 |
| Molecular Formula | C33H30F3NO |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | N-[5,5-bis(4-fluorophenyl)-2-methyl-1-(4-prop-2-enoxyphenyl)pent-4-enyl]-4-fluoroaniline |
| SMILES | C=CCOc1ccc(C(Nc2ccc(F)cc2)C(C)CC=C(c2ccc(F)cc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C33H30F3NO/c1-3-22-38-31-19-9-26(10-20-31)33(37-30-17-15-29(36)16-18-30)23(2)4-21-32(24-5-11-27(34)12-6-24)25-7-13-28(35)14-8-25/h3,5-21,23,33,37H,1,4,22H2,2H3 |
| InChIKey | ZYZHKDSIJIVGKE-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|