About (3R)-3,5-dimethyl-2,3-dihydro-1,4-oxazin-6-one
(3R)-3,5-dimethyl-2,3-dihydro-1,4-oxazin-6-one (PubChem CID 131982819) has the molecular formula C6H9NO2
and a molecular weight of 127.14 g/mol. Its IUPAC name is (3R)-3,5-dimethyl-2,3-dihydro-1,4-oxazin-6-one.
Molecular Properties
| Compound Name | (3R)-3,5-dimethyl-2,3-dihydro-1,4-oxazin-6-one |
| PubChem CID | 131982819 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | (3R)-3,5-dimethyl-2,3-dihydro-1,4-oxazin-6-one |
| SMILES | CC1=N[C@H](C)COC1=O |
| InChI | InChI=1S/C6H9NO2/c1-4-3-9-6(8)5(2)7-4/h4H,3H2,1-2H3/t4-/m1/s1 |
| InChIKey | LWDZEKDLMOCQMB-SCSAIBSYSA-N |
| XLogP | 0.39 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-3,5-dimethyl-2,3-dihydro-1,4-oxazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3,5-dimethyl-2,3-dihydro-1,4-oxazin-6-one?
The IUPAC name of (3R)-3,5-dimethyl-2,3-dihydro-1,4-oxazin-6-one (CID 131982819) is (3R)-3,5-dimethyl-2,3-dihydro-1,4-oxazin-6-one.
What is the SMILES notation for (3R)-3,5-dimethyl-2,3-dihydro-1,4-oxazin-6-one?
The canonical SMILES for (3R)-3,5-dimethyl-2,3-dihydro-1,4-oxazin-6-one is CC1=N[C@H](C)COC1=O.
What is the InChIKey of (3R)-3,5-dimethyl-2,3-dihydro-1,4-oxazin-6-one?
The InChIKey is LWDZEKDLMOCQMB-SCSAIBSYSA-N. The full InChI is InChI=1S/C6H9NO2/c1-4-3-9-6(8)5(2)7-4/h4H,3H2,1-2H3/t4-/m1/s1.
What are the key properties of (3R)-3,5-dimethyl-2,3-dihydro-1,4-oxazin-6-one?
(3R)-3,5-dimethyl-2,3-dihydro-1,4-oxazin-6-one has a molecular weight of 127.14 g/mol, XLogP of 0.39, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3,5-dimethyl-2,3-dihydro-1,4-oxazin-6-one is sourced from PubChem (CID 131982819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).