C23H36N4O4 — CID 131982896
N'-[[5-[4-(3-methoxypropoxy)-3-(oxan-4-yloxy)phenyl]-1H-pyrazol-4-yl]methyl]-N,N'-dimethylethane-1,2-diamine (PubChem CID 131982896) has the molecular formula C23H36N4O4 and a molecular weight of 432.57 g/mol. Its IUPAC name is N'-[[5-[4-(3-methoxypropoxy)-3-(oxan-4-yloxy)phenyl]-1H-pyrazol-4-yl]methyl]-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N'-[[5-[4-(3-methoxypropoxy)-3-(oxan-4-yloxy)phenyl]-1H-pyrazol-4-yl]methyl]-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 131982896 |
| Molecular Formula | C23H36N4O4 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | N'-[[5-[4-(3-methoxypropoxy)-3-(oxan-4-yloxy)phenyl]-1H-pyrazol-4-yl]methyl]-N,N'-dimethylethane-1,2-diamine |
| SMILES | CNCCN(C)Cc1cn[nH]c1-c1ccc(OCCCOC)c(OC2CCOCC2)c1 |
| InChI | InChI=1S/C23H36N4O4/c1-24-9-10-27(2)17-19-16-25-26-23(19)18-5-6-21(30-12-4-11-28-3)22(15-18)31-20-7-13-29-14-8-20/h5-6,15-16,20,24H,4,7-14,17H2,1-3H3,(H,25,26) |
| InChIKey | TYZIKPVAQDFJLZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|