C16H16S — CID 131983585
2,5-bis[(1Z)-buta-1,3-dienyl]-3,4-bis(ethenyl)thiophene (PubChem CID 131983585) has the molecular formula C16H16S and a molecular weight of 240.37 g/mol. Its IUPAC name is 2,5-bis[(1Z)-buta-1,3-dienyl]-3,4-bis(ethenyl)thiophene.
| Compound Name | 2,5-bis[(1Z)-buta-1,3-dienyl]-3,4-bis(ethenyl)thiophene |
|---|---|
| PubChem CID | 131983585 |
| Molecular Formula | C16H16S |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 2,5-bis[(1Z)-buta-1,3-dienyl]-3,4-bis(ethenyl)thiophene |
| SMILES | C=C/C=C\c1sc(/C=C\C=C)c(C=C)c1C=C |
| InChI | InChI=1S/C16H16S/c1-5-9-11-15-13(7-3)14(8-4)16(17-15)12-10-6-2/h5-12H,1-4H2/b11-9-,12-10- |
| InChIKey | GCOOPLBCIIWSIV-HWAYABPNSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|