C24H17Cl2FN2O5S2 — CID 131983986
N-[2-chloro-6-(4-chlorophenoxy)-4-pyridinyl]-4-fluoro-4-methylsulfonyl-2,3-dihydrothieno[3,2-g]chromene-7-carboxamide (PubChem CID 131983986) has the molecular formula C24H17Cl2FN2O5S2 and a molecular weight of 567.45 g/mol. Its IUPAC name is N-[2-chloro-6-(4-chlorophenoxy)-4-pyridinyl]-4-fluoro-4-methylsulfonyl-2,3-dihydrothieno[3,2-g]chromene-7-carboxamide.
| Compound Name | N-[2-chloro-6-(4-chlorophenoxy)-4-pyridinyl]-4-fluoro-4-methylsulfonyl-2,3-dihydrothieno[3,2-g]chromene-7-carboxamide |
|---|---|
| PubChem CID | 131983986 |
| Molecular Formula | C24H17Cl2FN2O5S2 |
| Molecular Weight | 567.45 g/mol |
| Exact Mass | 565.99 |
| IUPAC Name | N-[2-chloro-6-(4-chlorophenoxy)-4-pyridinyl]-4-fluoro-4-methylsulfonyl-2,3-dihydrothieno[3,2-g]chromene-7-carboxamide |
| SMILES | CS(=O)(=O)C1(F)CCOc2cc3sc(C(=O)Nc4cc(Cl)nc(Oc5ccc(Cl)cc5)c4)cc3cc21 |
| InChI | InChI=1S/C24H17Cl2FN2O5S2/c1-36(31,32)24(27)6-7-33-18-12-19-13(8-17(18)24)9-20(35-19)23(30)28-15-10-21(26)29-22(11-15)34-16-4-2-14(25)3-5-16/h2-5,8-12H,6-7H2,1H3,(H,28,29,30) |
| InChIKey | MAQBMZBBCCTSFR-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.45 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|