About N,N-dimethylprop-2-enamide;furan-2,5-dione
N,N-dimethylprop-2-enamide;furan-2,5-dione (PubChem CID 131984550) has the molecular formula C9H11NO4
and a molecular weight of 197.19 g/mol. Its IUPAC name is N,N-dimethylprop-2-enamide;furan-2,5-dione.
Molecular Properties
| Compound Name | N,N-dimethylprop-2-enamide;furan-2,5-dione |
| PubChem CID | 131984550 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | N,N-dimethylprop-2-enamide;furan-2,5-dione |
| SMILES | C=CC(=O)N(C)C.O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C5H9NO.C4H2O3/c1-4-5(7)6(2)3;5-3-1-2-4(6)7-3/h4H,1H2,2-3H3;1-2H |
| InChIKey | XFJXFTZLHXPQCF-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylprop-2-enamide;furan-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylprop-2-enamide;furan-2,5-dione?
The IUPAC name of N,N-dimethylprop-2-enamide;furan-2,5-dione (CID 131984550) is N,N-dimethylprop-2-enamide;furan-2,5-dione.
What is the SMILES notation for N,N-dimethylprop-2-enamide;furan-2,5-dione?
The canonical SMILES for N,N-dimethylprop-2-enamide;furan-2,5-dione is C=CC(=O)N(C)C.O=C1C=CC(=O)O1.
What is the InChIKey of N,N-dimethylprop-2-enamide;furan-2,5-dione?
The InChIKey is XFJXFTZLHXPQCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO.C4H2O3/c1-4-5(7)6(2)3;5-3-1-2-4(6)7-3/h4H,1H2,2-3H3;1-2H.
What are the key properties of N,N-dimethylprop-2-enamide;furan-2,5-dione?
N,N-dimethylprop-2-enamide;furan-2,5-dione has a molecular weight of 197.19 g/mol, XLogP of -0.11, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylprop-2-enamide;furan-2,5-dione is sourced from PubChem (CID 131984550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).