About 5-[(4-fluorophenyl)methyl]-6-methyl-1-(oxan-4-yl)pyrazolo[4,5-c]pyridin-4-one
5-[(4-fluorophenyl)methyl]-6-methyl-1-(oxan-4-yl)pyrazolo[4,5-c]pyridin-4-one (PubChem CID 131984840) has the molecular formula C19H20FN3O2
and a molecular weight of 341.39 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)methyl]-6-methyl-1-(oxan-4-yl)pyrazolo[4,5-c]pyridin-4-one.
Molecular Properties
| Compound Name | 5-[(4-fluorophenyl)methyl]-6-methyl-1-(oxan-4-yl)pyrazolo[4,5-c]pyridin-4-one |
| PubChem CID | 131984840 |
| Molecular Formula | C19H20FN3O2 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 5-[(4-fluorophenyl)methyl]-6-methyl-1-(oxan-4-yl)pyrazolo[4,5-c]pyridin-4-one |
| SMILES | Cc1cc2c(cnn2C2CCOCC2)c(=O)n1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C19H20FN3O2/c1-13-10-18-17(11-21-23(18)16-6-8-25-9-7-16)19(24)22(13)12-14-2-4-15(20)5-3-14/h2-5,10-11,16H,6-9,12H2,1H3 |
| InChIKey | LUDIBRFXTWLUSU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(4-fluorophenyl)methyl]-6-methyl-1-(oxan-4-yl)pyrazolo[4,5-c]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4-fluorophenyl)methyl]-6-methyl-1-(oxan-4-yl)pyrazolo[4,5-c]pyridin-4-one?
The IUPAC name of 5-[(4-fluorophenyl)methyl]-6-methyl-1-(oxan-4-yl)pyrazolo[4,5-c]pyridin-4-one (CID 131984840) is 5-[(4-fluorophenyl)methyl]-6-methyl-1-(oxan-4-yl)pyrazolo[4,5-c]pyridin-4-one.
What is the SMILES notation for 5-[(4-fluorophenyl)methyl]-6-methyl-1-(oxan-4-yl)pyrazolo[4,5-c]pyridin-4-one?
The canonical SMILES for 5-[(4-fluorophenyl)methyl]-6-methyl-1-(oxan-4-yl)pyrazolo[4,5-c]pyridin-4-one is Cc1cc2c(cnn2C2CCOCC2)c(=O)n1Cc1ccc(F)cc1.
What is the InChIKey of 5-[(4-fluorophenyl)methyl]-6-methyl-1-(oxan-4-yl)pyrazolo[4,5-c]pyridin-4-one?
The InChIKey is LUDIBRFXTWLUSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20FN3O2/c1-13-10-18-17(11-21-23(18)16-6-8-25-9-7-16)19(24)22(13)12-14-2-4-15(20)5-3-14/h2-5,10-11,16H,6-9,12H2,1H3.
What are the key properties of 5-[(4-fluorophenyl)methyl]-6-methyl-1-(oxan-4-yl)pyrazolo[4,5-c]pyridin-4-one?
5-[(4-fluorophenyl)methyl]-6-methyl-1-(oxan-4-yl)pyrazolo[4,5-c]pyridin-4-one has a molecular weight of 341.39 g/mol, XLogP of 3.05, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-fluorophenyl)methyl]-6-methyl-1-(oxan-4-yl)pyrazolo[4,5-c]pyridin-4-one is sourced from PubChem (CID 131984840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).