About 5-(cyclohexylmethyl)-6-methyl-1-propylpyrazolo[5,4-d]pyrimidin-4-one
5-(cyclohexylmethyl)-6-methyl-1-propylpyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 131984960) has the molecular formula C16H24N4O
and a molecular weight of 288.40 g/mol. Its IUPAC name is 5-(cyclohexylmethyl)-6-methyl-1-propylpyrazolo[5,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 5-(cyclohexylmethyl)-6-methyl-1-propylpyrazolo[5,4-d]pyrimidin-4-one |
| PubChem CID | 131984960 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 5-(cyclohexylmethyl)-6-methyl-1-propylpyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CCCn1ncc2c(=O)n(CC3CCCCC3)c(C)nc21 |
| InChI | InChI=1S/C16H24N4O/c1-3-9-20-15-14(10-17-20)16(21)19(12(2)18-15)11-13-7-5-4-6-8-13/h10,13H,3-9,11H2,1-2H3 |
| InChIKey | TYMBPQQASYCWEH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(cyclohexylmethyl)-6-methyl-1-propylpyrazolo[5,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(cyclohexylmethyl)-6-methyl-1-propylpyrazolo[5,4-d]pyrimidin-4-one?
The IUPAC name of 5-(cyclohexylmethyl)-6-methyl-1-propylpyrazolo[5,4-d]pyrimidin-4-one (CID 131984960) is 5-(cyclohexylmethyl)-6-methyl-1-propylpyrazolo[5,4-d]pyrimidin-4-one.
What is the SMILES notation for 5-(cyclohexylmethyl)-6-methyl-1-propylpyrazolo[5,4-d]pyrimidin-4-one?
The canonical SMILES for 5-(cyclohexylmethyl)-6-methyl-1-propylpyrazolo[5,4-d]pyrimidin-4-one is CCCn1ncc2c(=O)n(CC3CCCCC3)c(C)nc21.
What is the InChIKey of 5-(cyclohexylmethyl)-6-methyl-1-propylpyrazolo[5,4-d]pyrimidin-4-one?
The InChIKey is TYMBPQQASYCWEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N4O/c1-3-9-20-15-14(10-17-20)16(21)19(12(2)18-15)11-13-7-5-4-6-8-13/h10,13H,3-9,11H2,1-2H3.
What are the key properties of 5-(cyclohexylmethyl)-6-methyl-1-propylpyrazolo[5,4-d]pyrimidin-4-one?
5-(cyclohexylmethyl)-6-methyl-1-propylpyrazolo[5,4-d]pyrimidin-4-one has a molecular weight of 288.40 g/mol, XLogP of 2.89, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(cyclohexylmethyl)-6-methyl-1-propylpyrazolo[5,4-d]pyrimidin-4-one is sourced from PubChem (CID 131984960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).