About 7-bromo-5-fluoro-6-methoxy-1,2-benzothiazole
7-bromo-5-fluoro-6-methoxy-1,2-benzothiazole (PubChem CID 131985770) has the molecular formula C8H5BrFNOS
and a molecular weight of 262.10 g/mol. Its IUPAC name is 7-bromo-5-fluoro-6-methoxy-1,2-benzothiazole.
Molecular Properties
| Compound Name | 7-bromo-5-fluoro-6-methoxy-1,2-benzothiazole |
| PubChem CID | 131985770 |
| Molecular Formula | C8H5BrFNOS |
| Molecular Weight | 262.10 g/mol |
| Exact Mass | 260.93 |
| IUPAC Name | 7-bromo-5-fluoro-6-methoxy-1,2-benzothiazole |
| SMILES | COc1c(F)cc2cnsc2c1Br |
| InChI | InChI=1S/C8H5BrFNOS/c1-12-7-5(10)2-4-3-11-13-8(4)6(7)9/h2-3H,1H3 |
| InChIKey | GOUJHSJFBNPJRR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.10 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-bromo-5-fluoro-6-methoxy-1,2-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-5-fluoro-6-methoxy-1,2-benzothiazole?
The IUPAC name of 7-bromo-5-fluoro-6-methoxy-1,2-benzothiazole (CID 131985770) is 7-bromo-5-fluoro-6-methoxy-1,2-benzothiazole.
What is the SMILES notation for 7-bromo-5-fluoro-6-methoxy-1,2-benzothiazole?
The canonical SMILES for 7-bromo-5-fluoro-6-methoxy-1,2-benzothiazole is COc1c(F)cc2cnsc2c1Br.
What is the InChIKey of 7-bromo-5-fluoro-6-methoxy-1,2-benzothiazole?
The InChIKey is GOUJHSJFBNPJRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrFNOS/c1-12-7-5(10)2-4-3-11-13-8(4)6(7)9/h2-3H,1H3.
What are the key properties of 7-bromo-5-fluoro-6-methoxy-1,2-benzothiazole?
7-bromo-5-fluoro-6-methoxy-1,2-benzothiazole has a molecular weight of 262.10 g/mol, XLogP of 3.21, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-5-fluoro-6-methoxy-1,2-benzothiazole is sourced from PubChem (CID 131985770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).