About [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-amino-3-methylpentanoate
[2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-amino-3-methylpentanoate (PubChem CID 131985832) has the molecular formula C16H18N4O5S
and a molecular weight of 378.41 g/mol. Its IUPAC name is [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-amino-3-methylpentanoate.
Molecular Properties
| Compound Name | [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-amino-3-methylpentanoate |
| PubChem CID | 131985832 |
| Molecular Formula | C16H18N4O5S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-amino-3-methylpentanoate |
| SMILES | CCC(C)C(N)C(=O)Oc1ccccc1C(=O)Nc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C16H18N4O5S/c1-3-9(2)13(17)15(22)25-11-7-5-4-6-10(11)14(21)19-16-18-8-12(26-16)20(23)24/h4-9,13H,3,17H2,1-2H3,(H,18,19,21) |
| InChIKey | WOZVFXPPFKITEJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 137.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-amino-3-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-amino-3-methylpentanoate?
The IUPAC name of [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-amino-3-methylpentanoate (CID 131985832) is [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-amino-3-methylpentanoate.
What is the SMILES notation for [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-amino-3-methylpentanoate?
The canonical SMILES for [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-amino-3-methylpentanoate is CCC(C)C(N)C(=O)Oc1ccccc1C(=O)Nc1ncc([N+](=O)[O-])s1.
What is the InChIKey of [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-amino-3-methylpentanoate?
The InChIKey is WOZVFXPPFKITEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4O5S/c1-3-9(2)13(17)15(22)25-11-7-5-4-6-10(11)14(21)19-16-18-8-12(26-16)20(23)24/h4-9,13H,3,17H2,1-2H3,(H,18,19,21).
What are the key properties of [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-amino-3-methylpentanoate?
[2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-amino-3-methylpentanoate has a molecular weight of 378.41 g/mol, XLogP of 2.58, 7 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-amino-3-methylpentanoate is sourced from PubChem (CID 131985832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).