C16H18ClN3O3S — CID 131985852
[2-[(5-chloro-1,3-thiazol-2-yl)carbamoyl]phenyl] (2S)-2-amino-3,3-dimethylbutanoate (PubChem CID 131985852) has the molecular formula C16H18ClN3O3S and a molecular weight of 367.86 g/mol. Its IUPAC name is [2-[(5-chloro-1,3-thiazol-2-yl)carbamoyl]phenyl] (2S)-2-amino-3,3-dimethylbutanoate.
| Compound Name | [2-[(5-chloro-1,3-thiazol-2-yl)carbamoyl]phenyl] (2S)-2-amino-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 131985852 |
| Molecular Formula | C16H18ClN3O3S |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | [2-[(5-chloro-1,3-thiazol-2-yl)carbamoyl]phenyl] (2S)-2-amino-3,3-dimethylbutanoate |
| SMILES | CC(C)(C)[C@H](N)C(=O)Oc1ccccc1C(=O)Nc1ncc(Cl)s1 |
| InChI | InChI=1S/C16H18ClN3O3S/c1-16(2,3)12(18)14(22)23-10-7-5-4-6-9(10)13(21)20-15-19-8-11(17)24-15/h4-8,12H,18H2,1-3H3,(H,19,20,21)/t12-/m1/s1 |
| InChIKey | UOXSCWSIQODULA-GFCCVEGCSA-N |
| XLogP | 3.33 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|