C18H32N4O — CID 131985938
N'-[[2-(3,3-dimethyl-1-oxaspiro[4.5]decan-8-yl)pyrazol-3-yl]methyl]-N,N'-dimethylmethanediamine (PubChem CID 131985938) has the molecular formula C18H32N4O and a molecular weight of 320.48 g/mol. Its IUPAC name is N'-[[2-(3,3-dimethyl-1-oxaspiro[4.5]decan-8-yl)pyrazol-3-yl]methyl]-N,N'-dimethylmethanediamine.
| Compound Name | N'-[[2-(3,3-dimethyl-1-oxaspiro[4.5]decan-8-yl)pyrazol-3-yl]methyl]-N,N'-dimethylmethanediamine |
|---|---|
| PubChem CID | 131985938 |
| Molecular Formula | C18H32N4O |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.26 |
| IUPAC Name | N'-[[2-(3,3-dimethyl-1-oxaspiro[4.5]decan-8-yl)pyrazol-3-yl]methyl]-N,N'-dimethylmethanediamine |
| SMILES | CNCN(C)Cc1ccnn1C1CCC2(CC1)CC(C)(C)CO2 |
| InChI | InChI=1S/C18H32N4O/c1-17(2)12-18(23-13-17)8-5-15(6-9-18)22-16(7-10-20-22)11-21(4)14-19-3/h7,10,15,19H,5-6,8-9,11-14H2,1-4H3 |
| InChIKey | BHBZRASVDVQJHF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|